| Name |
Sodium 5,7-dichloroquinolin-8-yl sulfate
|
| Molecular Formula |
C9H4Cl2NNaO4S
|
| Molecular Weight |
316.09
|
| Smiles |
O=S(=O)([O-])Oc1c(Cl)cc(Cl)c2cccnc12.[Na+]
|
O=S(=O)([O-])Oc1c(Cl)cc(Cl)c2cccnc12.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.