| Name |
5-Methyl-2-(methylsulfanyl)-4-(4-{[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]methyl}piperazin-1-yl)pyrimidine
|
| Molecular Formula |
C14H17F3N6OS
|
| Molecular Weight |
374.39
|
| Smiles |
CSc1ncc(C)c(N2CCN(Cc3nnc(C(F)(F)F)o3)CC2)n1
|
CSc1ncc(C)c(N2CCN(Cc3nnc(C(F)(F)F)o3)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.