| Name |
7-(4-Methoxy-1,3-benzothiazol-2-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione
|
| Molecular Formula |
C14H14N4O3S
|
| Molecular Weight |
318.35
|
| Smiles |
COc1cccc2sc(N3CCC4(C3)NC(=O)NC4=O)nc12
|
COc1cccc2sc(N3CCC4(C3)NC(=O)NC4=O)nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.