| Name |
7-{2-Methylpyrido[3,4-d]pyrimidin-4-yl}-1,3,7-triazaspiro[4.4]nonane-2,4-dione
|
| Molecular Formula |
C14H14N6O2
|
| Molecular Weight |
298.30
|
| Smiles |
Cc1nc(N2CCC3(C2)NC(=O)NC3=O)c2ccncc2n1
|
Cc1nc(N2CCC3(C2)NC(=O)NC3=O)c2ccncc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.