| Name |
2-Bromo-3,5-dichloro-6-(1,1-dimethylethyl)pyridine
|
| Molecular Formula |
C9H10BrCl2N
|
| Molecular Weight |
282.99
|
| Smiles |
CC(C)(C)c1nc(Br)c(Cl)cc1Cl
|
CC(C)(C)c1nc(Br)c(Cl)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.