| Name |
[(6S,8S,9R,10S,11S,13S,14S,17R)-9-fluoro-6,11-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] butanoate
|
| Molecular Formula |
C25H33FO7
|
| Molecular Weight |
464.5
|
| Smiles |
CCCC(=O)OC1(C(=O)CO)CCC2C3CC(O)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C
|
CCCC(=O)OC1(C(=O)CO)CCC2C3CC(O)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.