| Name |
(2R,3S,E)-N,N-Bis(4-methoxybenzyl)-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-ene-2-sulfonamide
|
| Molecular Formula |
C29H42BNO6S
|
| Molecular Weight |
543.5
|
| Smiles |
COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)C(C)C(C)CC=CB2OC(C)(C)C(C)(C)O2)cc1
|
COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)C(C)C(C)CC=CB2OC(C)(C)C(C)(C)O2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.