| Name |
Pregna-1,4-diene-3,20-dione, 9,21-dichloro-17-[(2-furanylcarbonyl)oxy]-11-hydroxy-6,16-dimethyl-, (11beta,16alpha)-
|
| Molecular Formula |
C28H32Cl2O6
|
| Molecular Weight |
535.5
|
| Smiles |
CC1CC2C3CC(C)C(OC(=O)c4ccco4)(C(=O)CCl)C3(C)CC(O)C2(Cl)C2(C)C=CC(=O)C=C12
|
CC1CC2C3CC(C)C(OC(=O)c4ccco4)(C(=O)CCl)C3(C)CC(O)C2(Cl)C2(C)C=CC(=O)C=C12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.