| Name |
Androstane-3,6,7-triol, 17-methylene-, cyclic 6,7-(1-methylethylidene acetal), (3beta,5alpha,6alpha,7beta)-
|
| Molecular Formula |
C23H36O3
|
| Molecular Weight |
360.5
|
| Smiles |
C=C1CCC2C3C4OC(C)(C)OC4C4CC(O)CCC4(C)C3CCC12C
|
C=C1CCC2C3C4OC(C)(C)OC4C4CC(O)CCC4(C)C3CCC12C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.