| Name |
1-Methyl-4-{[4-(4-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]methyl}-1,2-dihydropyridin-2-one
|
| Molecular Formula |
C19H22N4OS
|
| Molecular Weight |
354.5
|
| Smiles |
Cc1cccc2sc(N3CCN(Cc4ccn(C)c(=O)c4)CC3)nc12
|
Cc1cccc2sc(N3CCN(Cc4ccn(C)c(=O)c4)CC3)nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.