| Name |
2-Cyclopropyl-4-(4-{2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl}piperazin-1-yl)-6-ethylpyrimidine
|
| Molecular Formula |
C21H27N7
|
| Molecular Weight |
377.5
|
| Smiles |
CCc1cc(N2CCN(c3cc(C)nc4cc(C)nn34)CC2)nc(C2CC2)n1
|
CCc1cc(N2CCN(c3cc(C)nc4cc(C)nn34)CC2)nc(C2CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.