| Name |
N,N-dimethyl-2-{4-[3-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}pyrimidin-4-amine
|
| Molecular Formula |
C16H19F3N6
|
| Molecular Weight |
352.36
|
| Smiles |
CN(C)c1ccnc(N2CCN(c3ncccc3C(F)(F)F)CC2)n1
|
CN(C)c1ccnc(N2CCN(c3ncccc3C(F)(F)F)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.