| Name |
2-Bromo-N-(2,4-dimethylphenyl)-4,6-dimethylaniline
|
| Molecular Formula |
C16H18BrN
|
| Molecular Weight |
304.22
|
| Smiles |
Cc1ccc(Nc2c(C)cc(C)cc2Br)c(C)c1
|
Cc1ccc(Nc2c(C)cc(C)cc2Br)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.