| Name |
(2R,6S)-4-(azidomethyl)-2,6-dimethyloxane
|
| Molecular Formula |
C8H15N3O
|
| Molecular Weight |
169.22
|
| Smiles |
CC1CC(CN=[N+]=[N-])CC(C)O1
|
CC1CC(CN=[N+]=[N-])CC(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.