| Name |
2-methyl-5-phenyl-2H-1,2,3-triazol-4-amine hydrochloride
|
| Molecular Formula |
C9H11ClN4
|
| Molecular Weight |
210.66
|
| Smiles |
Cl.Cn1nc(N)c(-c2ccccc2)n1
|
Cl.Cn1nc(N)c(-c2ccccc2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.