| Name |
Tert-butyl 4-((5-cyano-5'-hydroxy-2'-methoxy-[1,1'-biphenyl]-3-yl)oxy)piperidine-1-carboxylate
|
| Molecular Formula |
C24H28N2O5
|
| Molecular Weight |
424.5
|
| Smiles |
COc1ccc(O)cc1-c1cc(C#N)cc(OC2CCN(C(=O)OC(C)(C)C)CC2)c1
|
COc1ccc(O)cc1-c1cc(C#N)cc(OC2CCN(C(=O)OC(C)(C)C)CC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.