| Name |
2-methyl-6-({1-[(4-methyl-4H-1,2,4-triazol-3-yl)methyl]piperidin-3-yl}methoxy)pyridine
|
| Molecular Formula |
C16H23N5O
|
| Molecular Weight |
301.39
|
| Smiles |
Cc1cccc(OCC2CCCN(Cc3nncn3C)C2)n1
|
Cc1cccc(OCC2CCCN(Cc3nncn3C)C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.