| Name |
5-[(3As,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[(2-hydrazinylacetyl)amino]ethoxy]ethoxy]ethyl]pentanamide;dihydrochloride
|
| Molecular Formula |
C18H36Cl2N6O5S
|
| Molecular Weight |
519.5
|
| Smiles |
Cl.Cl.NNCC(=O)NCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21
|
Cl.Cl.NNCC(=O)NCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.