| Name |
3-(2-Methoxyethyl)-1-{1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl}imidazolidine-2,4-dione
|
| Molecular Formula |
C16H20F3N5O3
|
| Molecular Weight |
387.36
|
| Smiles |
COCCN1C(=O)CN(C2CCN(c3cc(C(F)(F)F)ncn3)CC2)C1=O
|
COCCN1C(=O)CN(C2CCN(c3cc(C(F)(F)F)ncn3)CC2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.