| Name |
2-{2-Oxo-2-[5-(6-phenylpyridazin-3-yl)-octahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl}-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C22H22N6O2
|
| Molecular Weight |
402.4
|
| Smiles |
O=C(Cn1ncccc1=O)N1CC2CN(c3ccc(-c4ccccc4)nn3)CC2C1
|
O=C(Cn1ncccc1=O)N1CC2CN(c3ccc(-c4ccccc4)nn3)CC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.