| Name |
4-ethyl-3-{1-[2-hydroxy-2-(thiophen-2-yl)ethyl]-1H-1,2,3-triazol-4-yl}-4,5-dihydro-1H-1,2,4-triazole-5-thione
|
| Molecular Formula |
C12H14N6OS2
|
| Molecular Weight |
322.4
|
| Smiles |
CCn1c(-c2cn(CC(O)c3cccs3)nn2)n[nH]c1=S
|
CCn1c(-c2cn(CC(O)c3cccs3)nn2)n[nH]c1=S
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.