| Name |
methyl 4-{[9-(2,4-dimethoxyphenyl)-4-oxo-4H,8H,9H,10H-chromeno[8,7-e][1,3]oxazin-3-yl]oxy}benzoate; propan-2-ol
|
| Molecular Formula |
C30H37NO9
|
| Molecular Weight |
555.6
|
| Smiles |
CC(C)O.COC(=O)c1ccc(OC2=COC3C(CCC4OCN(c5ccc(OC)cc5OC)CC43)C2=O)cc1
|
CC(C)O.COC(=O)c1ccc(OC2=COC3C(CCC4OCN(c5ccc(OC)cc5OC)CC43)C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.