| Name |
2-(3,4-Dimethoxybenzoyl)-5-{3-ethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl}-octahydropyrrolo[3,4-c]pyrrole
|
| Molecular Formula |
C22H26N6O3
|
| Molecular Weight |
422.5
|
| Smiles |
CCc1nnc2ccc(N3CC4CN(C(=O)c5ccc(OC)c(OC)c5)CC4C3)nn12
|
CCc1nnc2ccc(N3CC4CN(C(=O)c5ccc(OC)c(OC)c5)CC4C3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.