| Name |
4-Ethyl-3-methyl-6-[(1-{[1,3]thiazolo[4,5-c]pyridin-2-yl}piperidin-4-yl)methoxy]pyridazine
|
| Molecular Formula |
C19H23N5OS
|
| Molecular Weight |
369.5
|
| Smiles |
CCc1cc(OCC2CCN(c3nc4cnccc4s3)CC2)nnc1C
|
CCc1cc(OCC2CCN(c3nc4cnccc4s3)CC2)nnc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.