| Name |
8-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)tricyclo[3.2.1.0,2,7]octane-1-carboxylic acid
|
| Molecular Formula |
C24H23NO4
|
| Molecular Weight |
389.4
|
| Smiles |
O=C(NC1C2CCC3C(C2)C31C(=O)O)OCC1c2ccccc2-c2ccccc21
|
O=C(NC1C2CCC3C(C2)C31C(=O)O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.