| Name |
methyl (2Z)-3-methoxy-2-{2-methyl-5-[4-(trifluoromethyl)-1,3-thiazol-2-yl]phenoxy}prop-2-enoate
|
| Molecular Formula |
C16H14F3NO4S
|
| Molecular Weight |
373.3
|
| Smiles |
COC=C(Oc1cc(-c2nc(C(F)(F)F)cs2)ccc1C)C(=O)OC
|
COC=C(Oc1cc(-c2nc(C(F)(F)F)cs2)ccc1C)C(=O)OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.