| Name |
4-{Spiro[3.3]heptan-1-yl}benzoicacid
|
| Molecular Formula |
C14H16O2
|
| Molecular Weight |
216.27
|
| Smiles |
O=C(O)c1ccc(C2CCC23CCC3)cc1
|
O=C(O)c1ccc(C2CCC23CCC3)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.