| Name |
tert-Butyl 1,8,8-trimethyl-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate
|
| Molecular Formula |
C16H29N3O3
|
| Molecular Weight |
311.42
|
| Smiles |
CN1CCNC(=O)C12CCN(C(=O)OC(C)(C)C)C(C)(C)C2
|
CN1CCNC(=O)C12CCN(C(=O)OC(C)(C)C)C(C)(C)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.