| Name |
methyl (4R)-4-[(5S,6R,8S,9S,10S,13R,14S,17R)-6-ethyl-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
|
| Molecular Formula |
C27H42O4
|
| Molecular Weight |
430.6
|
| Smiles |
CCC1C(=O)C2C3CCC(C(C)CCC(=O)OC)C3(C)CCC2C2(C)CCC(=O)CC12
|
CCC1C(=O)C2C3CCC(C(C)CCC(=O)OC)C3(C)CCC2C2(C)CCC(=O)CC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.