| Name |
Estra-5(10),9(11)-diene-3,17-dione, 16-bromo-, cyclic 3-(1,2-ethanediyl acetal), (16|A)-(9CI)
|
| Molecular Formula |
C20H25BrO3
|
| Molecular Weight |
393.3
|
| Smiles |
CC12CC=C3C4=C(CCC3C1CC(Br)C2=O)CC1(CC4)OCCO1
|
CC12CC=C3C4=C(CCC3C1CC(Br)C2=O)CC1(CC4)OCCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.