| Name |
2,5,7-Trichloro-3-fluoro-1,6-naphthyridine
|
| Molecular Formula |
C8H2Cl3FN2
|
| Molecular Weight |
251.5
|
| Smiles |
Fc1cc2c(Cl)nc(Cl)cc2nc1Cl
|
Fc1cc2c(Cl)nc(Cl)cc2nc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.