| Name |
ethyl 4-(4-bromophenoxy)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate
|
| Molecular Formula |
C17H16BrN3O3
|
| Molecular Weight |
390.2
|
| Smiles |
CCOC(=O)c1cnc2c(c(C)nn2C)c1Oc1ccc(Br)cc1
|
CCOC(=O)c1cnc2c(c(C)nn2C)c1Oc1ccc(Br)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.