| Name |
2,6-Dibutanoyl-3,5-dihydroxy-4,4-dimethylcyclohexa-2,5-dien-1-one
|
| Molecular Formula |
C16H22O5
|
| Molecular Weight |
294.34
|
| Smiles |
CCCC(=O)C1=C(O)C(C(=O)CCC)=C(O)C(C)(C)C1=O
|
CCCC(=O)C1=C(O)C(C(=O)CCC)=C(O)C(C)(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.