| Name |
1-(1,1-Dimethylethyl) 2-ethyl 7-fluoro-1H-indole-1,2-dicarboxylate
|
| Molecular Formula |
C16H18FNO4
|
| Molecular Weight |
307.32
|
| Smiles |
CCOC(=O)c1cc2cccc(F)c2n1C(=O)OC(C)(C)C
|
CCOC(=O)c1cc2cccc(F)c2n1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.