| Name |
2-ethoxy-1-{3-[2-(propan-2-yl)-1H-1,3-benzodiazol-1-yl]azetidin-1-yl}ethan-1-one
|
| Molecular Formula |
C17H23N3O2
|
| Molecular Weight |
301.4
|
| Smiles |
CCOCC(=O)N1CC(n2c(C(C)C)nc3ccccc32)C1
|
CCOCC(=O)N1CC(n2c(C(C)C)nc3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.