| Name |
3-methoxy-N-methyl-N-({1-[(5-methylthiophen-2-yl)sulfonyl]piperidin-4-yl}methyl)pyrazin-2-amine
|
| Molecular Formula |
C17H24N4O3S2
|
| Molecular Weight |
396.5
|
| Smiles |
COc1nccnc1N(C)CC1CCN(S(=O)(=O)c2ccc(C)s2)CC1
|
COc1nccnc1N(C)CC1CCN(S(=O)(=O)c2ccc(C)s2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.