| Name |
4,6-Dimethyl-2-{5-phenyl-octahydropyrrolo[3,4-c]pyrrol-2-yl}pyrimidine
|
| Molecular Formula |
C18H22N4
|
| Molecular Weight |
294.4
|
| Smiles |
Cc1cc(C)nc(N2CC3CN(c4ccccc4)CC3C2)n1
|
Cc1cc(C)nc(N2CC3CN(c4ccccc4)CC3C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.