| Name |
2-Phenyl-5-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}-octahydropyrrolo[3,4-c]pyrrole
|
| Molecular Formula |
C17H18N6
|
| Molecular Weight |
306.4
|
| Smiles |
c1ccc(N2CC3CN(c4ccc5nncn5n4)CC3C2)cc1
|
c1ccc(N2CC3CN(c4ccc5nncn5n4)CC3C2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.