| Name |
2-Phenyl-5-{pyrido[3,4-d]pyrimidin-4-yl}-octahydropyrrolo[3,4-c]pyrrole-1,3-dione
|
| Molecular Formula |
C19H15N5O2
|
| Molecular Weight |
345.4
|
| Smiles |
O=C1C2CN(c3ncnc4cnccc34)CC2C(=O)N1c1ccccc1
|
O=C1C2CN(c3ncnc4cnccc34)CC2C(=O)N1c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.