| Name |
tert-Butyl 4-methoxy-1-oxo-1,3-dihydrospiro[indene-2,4'-piperidine]-1'-carboxylate
|
| Molecular Formula |
C19H25NO4
|
| Molecular Weight |
331.4
|
| Smiles |
COc1cccc2c1CC1(CCN(C(=O)OC(C)(C)C)CC1)C2=O
|
COc1cccc2c1CC1(CCN(C(=O)OC(C)(C)C)CC1)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.