| Name |
N-cyclobutyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetamide
|
| Molecular Formula |
C18H26BNO4
|
| Molecular Weight |
331.2
|
| Smiles |
CC1(C)OB(c2cccc(OCC(=O)NC3CCC3)c2)OC1(C)C
|
CC1(C)OB(c2cccc(OCC(=O)NC3CCC3)c2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.