| Name |
2-({1-[(5-Methyl-1,2,4-oxadiazol-3-yl)methyl]piperidin-4-yl}oxy)-4-(trifluoromethyl)pyrimidine
|
| Molecular Formula |
C14H16F3N5O2
|
| Molecular Weight |
343.30
|
| Smiles |
Cc1nc(CN2CCC(Oc3nccc(C(F)(F)F)n3)CC2)no1
|
Cc1nc(CN2CCC(Oc3nccc(C(F)(F)F)n3)CC2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.