| Name |
4-(3'-Bromo-[1,1'-biphenyl]-3-yl)-2,6-diphenylpyrimidine
|
| Molecular Formula |
C28H19BrN2
|
| Molecular Weight |
463.4
|
| Smiles |
Brc1cccc(-c2cccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1
|
Brc1cccc(-c2cccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.