| Name |
2-{5-[(3,5-Dimethyl-1,2-oxazol-4-yl)methyl]-octahydropyrrolo[3,4-c]pyrrol-2-yl}-5-(trifluoromethyl)pyridine
|
| Molecular Formula |
C18H21F3N4O
|
| Molecular Weight |
366.4
|
| Smiles |
Cc1noc(C)c1CN1CC2CN(c3ccc(C(F)(F)F)cn3)CC2C1
|
Cc1noc(C)c1CN1CC2CN(c3ccc(C(F)(F)F)cn3)CC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.