| Name |
5-bromo-2-({1-[(4,5-dimethyl-4H-1,2,4-triazol-3-yl)methyl]piperidin-4-yl}oxy)pyrimidine
|
| Molecular Formula |
C14H19BrN6O
|
| Molecular Weight |
367.24
|
| Smiles |
Cc1nnc(CN2CCC(Oc3ncc(Br)cn3)CC2)n1C
|
Cc1nnc(CN2CCC(Oc3ncc(Br)cn3)CC2)n1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.