| Name |
N-(2-{[4-(2,2-dimethylpropanoyl)phenyl]carbamoyl}ethyl)prop-2-enamide
|
| Molecular Formula |
C17H22N2O3
|
| Molecular Weight |
302.37
|
| Smiles |
C=CC(=O)NCCC(=O)Nc1ccc(C(=O)C(C)(C)C)cc1
|
C=CC(=O)NCCC(=O)Nc1ccc(C(=O)C(C)(C)C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.