| Name |
5-Methoxy-1H-pyrazolo[3,4-b]pyridin-3(2H)-one
|
| Molecular Formula |
C7H7N3O2
|
| Molecular Weight |
165.15
|
| Smiles |
COc1cnc2[nH][nH]c(=O)c2c1
|
COc1cnc2[nH][nH]c(=O)c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.