| Name |
1-(1,4-Dioxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
|
| Molecular Formula |
C13H21BN2O4
|
| Molecular Weight |
280.13
|
| Smiles |
CC1(C)OB(c2ccn(C3COCCO3)n2)OC1(C)C
|
CC1(C)OB(c2ccn(C3COCCO3)n2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.