| Name |
3-(14-(4-Aminophenoxy)-3,6,9,12-tetraoxatetradecyl)-1-methyl-1H-imidazol-3-ium bis((trifluoromethyl)sulfonyl)amide
|
| Molecular Formula |
C22H32F6N4O9S2
|
| Molecular Weight |
674.6
|
| Smiles |
C[n+]1ccn(CCOCCOCCOCCOCCOc2ccc(N)cc2)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F
|
C[n+]1ccn(CCOCCOCCOCCOCCOc2ccc(N)cc2)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.