| Name |
(2E)-4-(dimethylamino)-N-({5H,6H,7H,8H-imidazo[1,2-a]pyridin-5-yl}methyl)but-2-enamide
|
| Molecular Formula |
C14H22N4O
|
| Molecular Weight |
262.35
|
| Smiles |
CN(C)CC=CC(=O)NCC1CCCc2nccn21
|
CN(C)CC=CC(=O)NCC1CCCc2nccn21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.